| Name |
Farnesal |
| Formula |
C15H24O |
| Mw |
220.18271539 |
| CAS RN |
19317-11-4 |
| C_ID |
C00030246
, 
|
| InChIKey |
YHRUHBBTQZKMEX-YFVJMOTDSA-N |
| InChICode |
InChI=1S/C15H24O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11-12H,5-6,8,10H2,1-4H3/b14-9+,15-11+ |
| SMILES |
CC(C)=CCC/C(C)=C/CC/C(C)=C/C=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia annua L.cultivar Jwarharti  | Ref. |
| Plantae | Zingiberaceae | Curcuma amada | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale | Ref. |
|
|
zoom in
| Organism | Zingiber officinale |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
