| Name |
Detetrahydroconidendrin |
| Formula |
C20H16O6 |
| Mw |
352.09468824 |
| CAS RN |
19463-47-9 |
| C_ID |
C00030122
, 
|
| InChIKey |
JJVJBPKUTANWEW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H16O6/c1-24-17-6-10(3-4-15(17)21)19-12-8-16(22)18(25-2)7-11(12)5-13-14(19)9-26-20(13)23/h3-8,21-22H,9H2,1-2H3 |
| SMILES |
COc1cc(-c2c3c(cc4cc(OC)c(O)cc24)C(=O)OC3)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cupressaceae | Juniperus formosana Hayata. | Ref. |
| Plantae | Labiatae | Vitex cannabifolia Sieb.et.Zucc. | Ref. |
| Plantae | Labiatae | Vitex negundo  | Ref. |
| Plantae | Labiatae | Vitex rotundifolia  | Ref. |
|
|
zoom in
| Organism | Vitex negundo | | Reference | Ono, et al., Journal of Natural Products, 67, (2004), 2073.
Kawazoe, et al., Journal of Natural Products, 64, (2001), 588. |
|---|
|