| Name |
Anofinic acid 1-Hydroxy-3',3'-dimethylchromene |
| Formula |
C12H12O3 |
| Mw |
204.07864425 |
| CAS RN |
34818-56-9 |
| C_ID |
C00029692
, 
|
| InChIKey |
AXICIBPYBONRSP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H12O3/c1-12(2)6-5-8-7-9(11(13)14)3-4-10(8)15-12/h3-7H,1-2H3,(H,13,14) |
| SMILES |
CC1(C)C=Cc2cc(C(=O)O)ccc2O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Russulaceae | Lactarius deliciosus  | Ref. |
| Plantae | Apocynaceae | Anodendron affine | Ref. |
| Plantae | Gentianaceae | Gentiana algida | Ref. |
| Plantae | Piperaceae | Piper aduncum  | Ref. |
|
|
zoom in
| Organism | Gentiana algida | | Reference | Baldoqui, et al., Phytochemistry, 51, (1999), 899.
Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001).
Tan, et al., Phytochemistry, 41, (1996), 111. |
|---|
|