| Name |
5-Caffeoylquinic acid methyl ester 5-O-Caffeoylquinic acid methyl ester |
| Formula |
C17H20O9 |
| Mw |
368.11073224 |
| CAS RN |
123410-65-1 |
| C_ID |
C00029558
, 
|
| InChIKey |
MZNIJRAPCCELQX-MAOLCBASNA-N |
| InChICode |
InChI=1S/C17H20O9/c1-25-16(23)17(24)7-12(20)15(22)13(8-17)26-14(21)5-3-9-2-4-10(18)11(19)6-9/h2-6,12-13,15,18-20,22,24H,7-8H2,1H3/b5-3+/t12-,13-,15+,17-/m1/s1 |
| SMILES |
COC(=O)[C@@]1(O)C[C@@H](O)[C@H](O)[C@H](OC(=O)/C=C/c2ccc(O)c(O)c2)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Ostericum koreanum | Ref. |
| Plantae | Asteraceae | Saussurea medusa | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
|
|
zoom in
| Organism | Capsicum annuum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|