| Name |
2-Nonanone Nonan-2-one |
| Formula |
C9H18O |
| Mw |
142.1357652 |
| CAS RN |
821-55-6 |
| C_ID |
C00029463
, 
|
| InChIKey |
VKCYHJWLYTUGCC-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C9H18O/c1-3-4-5-6-7-8-9(2)10/h3-8H2,1-2H3 |
| SMILES |
CCCCCCCC(C)=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Pseudomonadaceae | Pseudomonas aeruginosa | Ref. |
| Plantae | Annonaceae | Annona glabra  | Ref. |
| Plantae | Asteraceae | Artemisia capillaris  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Oxalidaceae | Averrhoa carambola  | Ref. |
| Plantae | Rubiaceae | Coffea arabica  | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Zingiberaceae | Curcuma aeruginosa  | Ref. |
| Plantae | Zingiberaceae | Curcuma amada  | Ref. |
| Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
| Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
| Plantae | Zingiberaceae | Curcuma zedoaria  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Caffea sp. | Ref. |
|
|
zoom in
| Organism | Artemisia capillaris | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|