| Name |
Stemofoline (+)-Stemofoline |
| Formula |
C22H29NO5 |
| Mw |
387.20457304 |
| CAS RN |
29881-57-0 |
| C_ID |
C00029045
, 
|
| InChIKey |
DTVYAHOULQCSMS-DPZSBRFLNA-N |
| InChICode |
InChI=1S/C22H29NO5/c1-5-6-8-21-14-7-9-23(21)13-10-15(21)27-22(14)16(13)11(2)18(28-22)19-17(25-4)12(3)20(24)26-19/h11,13-16H,5-10H2,1-4H3/b19-18-/t11-,13-,14+,15-,16+,21-,22-/m0/s1 |
| SMILES |
CCCC[C@@]12[C@@H]3CC4C5[C@H](C)/C(=C6/OC(=O)C(C)=C6OC)OC5(O3)[C@@H]1CCN42 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Stemonaceae | Stemona aphylla | Ref. |
| Plantae | Stemonaceae | Stemona burkillii | Ref. |
| Plantae | Stemonaceae | Stemona cochinchinensis | Ref. |
| Plantae | Stemonaceae | Stemona collinsae | Ref. |
| Plantae | Stemonaceae | Stemona curtisii | Ref. |
| Plantae | Stemonaceae | Stemona japonica  | Ref. |
| Plantae | Stemonaceae | Stemona parviflora | Ref. |
|
|
zoom in
| Organism | Stemona cochinchinensis | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Kaltenegger, et al., Phytochemistry, 63, (2003), 803.
Karikome, Wen-ben Yang translated, Phytochemistry, Science Press, Beijing, (1985)
Schinnerl,Phytochem.,68,(2007),1417 |
|---|
|