| Name |
Puqiedinone Zhebeirine |
| Formula |
C27H43NO2 |
| Mw |
413.32937962 |
| CAS RN |
143120-47-2 |
| C_ID |
C00028888
, 
|
| InChIKey |
MWBJDDYEYGDWCZ-BCYAKLHYNA-N |
| InChICode |
InChI=1S/C27H43NO2/c1-15-4-7-25-16(2)18-5-6-19-20(22(18)14-28(25)13-15)11-23-21(19)12-26(30)24-10-17(29)8-9-27(23,24)3/h15-25,29H,4-14H2,1-3H3/t15-,16-,17+,18-,19-,20-,21+,22-,23+,24-,25+,27-/m1/s1 |
| SMILES |
C[C@@H]1CC[C@H]2[C@H](C)[C@H]3CC[C@@H]4[C@@H](C[C@H]5[C@H]4CC(=O)[C@H]4C[C@@H](O)CC[C@@]45C)[C@@H]3CN2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg L-Asp Cholesterol |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Liliaceae | Fritillaria puqiensis | Ref. |
| Plantae | Liliaceae | Fritillaria thunbergii  | Ref. |
| Plantae | Liliaceae | Fritillaria verticillata var.thunbergii  | Ref. |
|
|
zoom in
| Organism | Fritillaria verticillata var.thunbergii | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|