| Name |
beta-Yohimbine |
| Formula |
C21H26N2O3 |
| Mw |
354.19434271 |
| CAS RN |
549-84-8 |
| C_ID |
C00027935
, 
|
| InChIKey |
BLGXFZZNTVWLAY-XVXAGGFJNA-N |
| InChICode |
InChI=1S/C21H26N2O3/c1-26-21(25)19-15-10-17-20-14(13-4-2-3-5-16(13)22-20)8-9-23(17)11-12(15)6-7-18(19)24/h2-5,12,15,17-19,22,24H,6-11H2,1H3/t12-,15+,17-,18+,19+/m0/s1 |
| SMILES |
COC(=O)[C@@H]1[C@H]2C[C@H]3c4[nH]c5ccccc5c4CCN3C[C@@H]2CC[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Aspidosperma ramiflorum Muell.-Arg. | Ref. |
| Plantae | Apocynaceae | Haplophyton crooksii L.Benson | Ref. |
| Plantae | Apocynaceae | Rauwolfia verticillata | Ref. |
|
|
zoom in
| Organism | Rauwolfia verticillata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|