| Name |
Fumarofine |
| Formula |
C20H19NO6 |
| Mw |
369.12123735 |
| CAS RN |
34114-84-6 |
| C_ID |
C00027540
, 
|
| InChIKey |
BJGPRDJBNLOGMI-HOFUVJEBNA-N |
| InChICode |
InChI=1S/C20H19NO6/c1-21-6-5-10-7-15(25-2)13(22)8-12(10)20(24)18(21)11-3-4-14-17(27-9-26-14)16(11)19(20)23/h3-4,7-8,18,22,24H,5-6,9H2,1-2H3/t18-,20+/m0/s1 |
| SMILES |
COc1cc2c(cc1O)[C@]1(O)C(=O)c3c(ccc4c3OCO4)[C@@H]1N(C)CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Fumaria densiflora | Ref. |
| Plantae | Fumariaceae | Fumaria microcarpa | Ref. |
| Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
|
|
zoom in
| Organism | Fumaria officinalis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|