| Name |
Launobine (+)-Launobine |
| Formula |
C18H17NO4 |
| Mw |
311.11575804 |
| CAS RN |
20497-21-6 |
| C_ID |
C00027407
, 
|
| InChIKey |
JIFBCUOVFPCZEW-LDGXTIHJNA-N |
| InChICode |
InChI=1S/C18H17NO4/c1-21-12-3-2-9-6-11-14-10(4-5-19-11)7-13-18(23-8-22-13)16(14)15(9)17(12)20/h2-3,7,11,19-20H,4-6,8H2,1H3/t11-/m0/s1 |
| SMILES |
COc1ccc2c(c1O)-c1c3c(cc4c1[C@H](C2)NCC4)OCO3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Hernandiaceae | Illigera luzonensis | Ref. |
| Plantae | Lauraceae | Cassytha americana | Ref. |
| Plantae | Lauraceae | Laurus nobilis  | Ref. |
| Plantae | Lauraceae | Lindera umbellata  | Ref. |
| Plantae | Lauraceae | Litsea pungens | Ref. |
|
|
zoom in
| Organism | Laurus nobilis | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chen, et al., Journal of Natural Products, 60, (1997), 645.
Chem Abstr, 72, (1970), 974g |
|---|
|