| Name |
Isosalutaridine |
| Formula |
C19H21NO4 |
| Mw |
327.14705817 |
| CAS RN |
23599-67-9 |
| C_ID |
C00027394
, 
|
| InChIKey |
FBCNBECEGOCMPI-VJMUFYRVNA-N |
| InChICode |
InChI=1S/C19H21NO4/c1-20-5-4-19-10-18(24-3)16(22)8-13(19)14(20)6-11-7-15(21)17(23-2)9-12(11)19/h7-10,14,21H,4-6H2,1-3H3/t14-,19-/m1/s1 |
| SMILES |
COC1=C[C@]23CCN(C)[C@H](Cc4cc(O)c(OC)cc42)C3=CC1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Euphorbiaceae | Croton chilensis | Ref. |
| Plantae | Fumariaceae | Ceratocapnos palaestinus | Ref. |
| Plantae | Fumariaceae | Fumaria densiflora | Ref. |
|
|
zoom in
| Organism | Fumaria densiflora | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|