| Name |
Nantenine
(+)-Domestine
(+)-Nantenine
O-Methyl domesticine |
| Formula |
C20H21NO4 |
| Mw |
339.14705817 |
| CAS RN |
2565-01-7 |
| C_ID |
C00027150
, 
|
| InChIKey |
WSVWKHTVFGTTKJ-YQTOOIBONA-N |
| InChICode |
InChI=1S/C20H21NO4/c1-21-5-4-11-7-17(22-2)20(23-3)19-13-9-16-15(24-10-25-16)8-12(13)6-14(21)18(11)19/h7-9,14H,4-6,10H2,1-3H3/t14-/m0/s1 |
| SMILES |
COc1cc2c3c(c1OC)-c1cc4c(cc1C[C@@H]3N(C)CC2)OCO4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Xylopia aromatica  | Ref. |
| Plantae | Annonaceae | Xylopia frutescens | Ref. |
| Plantae | Berberidaceae | Nandina domestica | Ref. |
| Plantae | Fumariaceae | Corydalis ochroleuca | Ref. |
| Plantae | Fumariaceae | Corydalis solida | Ref. |
| Plantae | Lauraceae | Dehaasia triandra | Ref. |
| Plantae | Monimiaceae | Siparuna pauciflora | Ref. |
|
|
zoom in
| Organism | Nandina domestica |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Tomida, et al., J of Pharm Society(Japan), 81, (1961), 1090 |
|---|
|
