| Name |
Sitsirikine |
| Formula |
C21H26N2O3 |
| Mw |
354.19434271 |
| CAS RN |
1245-00-7 |
| C_ID |
C00027077
, 
|
| InChIKey |
JGKCGXVOATXMRM-IYBGCKNFNA-N |
| InChICode |
InChI=1S/C21H26N2O3/c1-3-13-11-23-9-8-15-14-6-4-5-7-18(14)22-20(15)19(23)10-16(13)17(12-24)21(25)26-2/h3-7,13,16-17,19,22,24H,1,8-12H2,2H3/t13-,16+,17-,19-/m0/s1 |
| SMILES |
C=C[C@H]1CN2CCc3c([nH]c4ccccc34)[C@@H]2CC1[C@H](CO)C(=O)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Alstonia angustifolia | Ref. |
| Plantae | Apocynaceae | Alstonia angustifolia var.latifolia | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Rauwolfia verticillata | Ref. |
|
|
zoom in
| Organism | Catharanthus roseus | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|