| Name |
Heleurine (-)-Heleurine O3-Methylsupinine |
| Formula |
C16H27NO4 |
| Mw |
297.19400836 |
| CAS RN |
488-00-6 |
| C_ID |
C00026197
, 
|
| InChIKey |
AORFDVNAPHMKAU-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C16H27NO4/c1-11(2)16(19,12(3)20-4)15(18)21-10-13-7-9-17-8-5-6-14(13)17/h7,11-12,14,19H,5-6,8-10H2,1-4H3/t12-,14-,16-/m1/s1 |
| SMILES |
COC(C)C(O)(C(=O)OCC1=CCN2CCCC12)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Ala |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Heliotropium bacciferum  | Ref. |
| Plantae | Boraginaceae | Heliotropium circinatum | Ref. |
| Plantae | Boraginaceae | Heliotropium europaeum  | Ref. |
| Plantae | Boraginaceae | Heliotropium hirsutissimum | Ref. |
| Plantae | Boraginaceae | Heliotropium indicum  | Ref. |
|
|
zoom in
| Organism | Heliotropium europaeum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|