| Name |
Groenlandicine |
| Formula |
C19H16NO4 |
| Mw |
322.10793301 |
| CAS RN |
38691-95-1 |
| C_ID |
C00026131
, 
|
| InChIKey |
PGIOBGCIEGZHJH-UHFFFAOYSA-O |
| InChICode |
InChI=1S/C19H15NO4/c1-22-18-8-13-12(7-16(18)21)4-5-20-9-14-11(6-15(13)20)2-3-17-19(14)24-10-23-17/h2-3,6-9H,4-5,10H2,1H3/p+1 |
| SMILES |
COc1cc2c(cc1O)CC[n+]1cc3c4c(ccc3cc1-2)OCO4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Cineraria deltoidea | Ref. |
| Plantae | Asteraceae | Cineraria quinquefolia | Ref. |
| Plantae | Ranunculaceae | Coptis chinensis  | Ref. |
| Plantae | Ranunculaceae | Coptis groenlandica | Ref. |
| Plantae | Ranunculaceae | Coptis spp. | Ref. |
|
|
zoom in
| Organism | Coptis chinensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|