| Name |
Berberrubine 9-Berberoline |
| Formula |
C19H16NO4 |
| Mw |
322.10793301 |
| CAS RN |
17388-19-1 |
| C_ID |
C00026111
, 
|
| InChIKey |
GLYPKDKODVRYGP-UHFFFAOYSA-O |
| InChICode |
InChI=1S/C19H15NO4/c1-22-16-3-2-11-6-15-13-8-18-17(23-10-24-18)7-12(13)4-5-20(15)9-14(11)19(16)21/h2-3,6-9H,4-5,10H2,1H3/p+1 |
| SMILES |
COc1ccc2cc3[n+](cc2c1O)CCc1cc2c(cc1-3)OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Berberis actinacantha | Ref. |
| Plantae | Berberidaceae | Berberis amurensis  | Ref. |
| Plantae | Berberidaceae | Berberis darwinii  | Ref. |
| Plantae | Berberidaceae | Berberis iliensis | Ref. |
| Plantae | Berberidaceae | Berberis turcomanica | Ref. |
| Plantae | Berberidaceae | Berberis valdiviana | Ref. |
| Plantae | Berberidaceae | Berberis vulgaris  | Ref. |
| Plantae | Menispermaceae | Coscinium fenestratum (Gaertn.)Colebr.  | Ref. |
| Plantae | Menispermaceae | Fibraurea chloroleuca Miers | Ref. |
| Plantae | Menispermaceae | Fibraurea chloroleuca Miore. | Ref. |
| Plantae | Ranunculaceae | Thalictrum glandulosissimum | Ref. |
| Plantae | Ranunculaceae | Thalictrum polygamum Muhl | Ref. |
| Plantae | Ranunculaceae | Thalictrum polyganum | Ref. |
|
|
zoom in
| Organism | Berberis darwinii | | Reference | Tang, et al., Planta Med, 69, (2003), 97.
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986). |
|---|
|