| Name |
8-Oxocoptisine |
| Formula |
C19H13NO5 |
| Mw |
335.07937253 |
| CAS RN |
19716-61-1 |
| C_ID |
C00026107
, 
|
| InChIKey |
UCAFJBSQKXVPDX-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H13NO5/c21-19-17-11(1-2-14-18(17)25-9-22-14)5-13-12-7-16-15(23-8-24-16)6-10(12)3-4-20(13)19/h1-2,5-7H,3-4,8-9H2 |
| SMILES |
O=c1c2c3c(ccc2cc2n1CCc1cc4c(cc1-2)OCO4)OCO3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Corydalis claviculata | Ref. |
| Plantae | Fumariaceae | Fumaria indica  | Ref. |
| Plantae | Fumariaceae | Fumaria kralikii | Ref. |
| Plantae | Fumariaceae | Fumaria parviflora Lam.  | Ref. |
| Plantae | Papaveraceae | Chelidonium majus  | Ref. |
| Plantae | Ranunculaceae | Thalictrum glandulosissimum | Ref. |
|
|
zoom in
| Organism | Fumaria kralikii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|