| Name |
(+)-Tetraphyllicine Serpinin Serpinine Tetraphyllicin |
| Formula |
C20H24N2O |
| Mw |
308.1888634 |
| CAS RN |
509-38-6 |
| C_ID |
C00026059
, 
|
| InChIKey |
VBEQZFNVRMPLSM-NOBYKHTGNA-N |
| InChICode |
InChI=1S/C20H24N2O/c1-3-11-10-22-15-8-12(11)17-16(22)9-20(19(17)23)13-6-4-5-7-14(13)21(2)18(15)20/h3-7,12,15-19,23H,8-10H2,1-2H3/b11-3-/t12-,15-,16-,17-,18-,19+,20+/m0/s1 |
| SMILES |
C/C=C1/CN2[C@H]3C[C@@]45c6ccccc6N(C)[C@H]4[C@@H]2CC1C3[C@H]5O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Rauwolfia serpentina | Ref. |
| Plantae | Apocynaceae | Rauwolfia verticillata | Ref. |
| Plantae | Apocynaceae | Tabernaemontana coffeoides Boj. | Ref. |
|
|
zoom in
| Organism | Rauwolfia verticillata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|