| Name |
(+)-Tricordatine Tricordatine |
| Formula |
C34H32N2O5 |
| Mw |
548.23112215 |
| CAS RN |
51076-20-1 |
| C_ID |
C00025689
, 
|
| InChIKey |
ZMFKWCVOCDSEST-QYRYXDJWNA-N |
| InChICode |
InChI=1S/C34H32N2O5/c1-35-11-9-21-17-30-31-18-24(21)25(35)14-20-5-8-27(37)29(15-20)39-23-6-3-19(4-7-23)13-26-32-22(10-12-36(26)2)16-28(38)33(40-30)34(32)41-31/h3-8,15-18,25-26,37-38H,9-14H2,1-2H3/t25-,26-/m0/s1 |
| SMILES |
CN1CCc2cc3c4cc2[C@@H]1Cc1ccc(O)c(c1)Oc1ccc(cc1)C[C@H]1c2c(cc(O)c(c2O4)O3)CCN1C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Menispermaceae | Cocculus pendulus (Forsk.) Diels  | Ref. |
| Plantae | Menispermaceae | Pachygone dasycarpa Kurz | Ref. |
| Plantae | Menispermaceae | Triclisia subcordata Oliv. | Ref. |
|
|
zoom in
| Organism | Triclisia subcordata Oliv. | | Reference | Tackie,Summary of the work on some Menispermaceae plants of Ghana.African Medicinal Plants Proc.Conf.Univ.Ife,Nigeria.,p.112 |
|---|
|