| Name |
Tetrahydroalstonine |
| Formula |
C21H24N2O3 |
| Mw |
352.17869265 |
| CAS RN |
6474-90-4 |
| C_ID |
C00025214
, 
|
| InChIKey |
GRTOGORTSDXSFK-OQKXSRFBNA-N |
| InChICode |
InChI=1S/C21H24N2O3/c1-12-16-10-23-8-7-14-13-5-3-4-6-18(13)22-20(14)19(23)9-15(16)17(11-26-12)21(24)25-2/h3-6,11-12,15-16,19,22H,7-10H2,1-2H3/t12-,15-,16-,19-/m0/s1 |
| SMILES |
COC(=O)C1=CO[C@@H](C)[C@@H]2CN3CCc4c([nH]c5ccccc45)[C@@H]3C[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Alstonia mairei | Ref. |
| Plantae | Apocynaceae | Alstonia restricta | Ref. |
| Plantae | Apocynaceae | Alstonia scholaris  | Ref. |
| Plantae | Apocynaceae | Alstonia yunnanensis | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Kopsia dasyrachis | Ref. |
| Plantae | Apocynaceae | Kopsia griffithii | Ref. |
| Plantae | Apocynaceae | Ochrosia elliptica Labill. | Ref. |
| Plantae | Apocynaceae | Rauvolfia serpentina  | Ref. |
| Plantae | Apocynaceae | Rauvolfia vomitoria  | Ref. |
| Plantae | Apocynaceae | Tabernaemontana psorocarpa (Pierre ex Stapf)Pichon | Ref. |
| Plantae | Apocynaceae | Tabernaemontana siphilitica Leeuwenberg | Ref. |
| Plantae | Rubiaceae | Uncaria attenuata Korth. | Ref. |
| Plantae | Rubiaceae | Uncaria elliptica R.Br.ex G.Don. | Ref. |
|
|
zoom in
| Organism | Alstonia scholaris | | Reference | Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Li, et al., ABY, 20, (1998), 244.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|