| Name |
Pseudobrucine 16-Hydroxybrucine |
| Formula |
C23H26N2O5 |
| Mw |
410.18417196 |
| CAS RN |
560-30-5 |
| C_ID |
C00025199
, 
|
| InChIKey |
JNNROFOMHXIAMQ-KFOJDFCVNA-N |
| InChICode |
InChI=1S/C23H26N2O5/c1-28-16-7-14-15(8-17(16)29-2)25-19(26)9-18-20-13-10-23(27)22(14,21(20)25)4-5-24(23)11-12(13)3-6-30-18/h3,7-8,13,18,20-21,27H,4-6,9-11H2,1-2H3/t13-,18-,20-,21-,22-,23+/m0/s1 |
| SMILES |
COc1cc2c(cc1OC)[C@@]13CCN4CC5=CCO[C@H]6CC(=O)N2[C@H]1[C@H]6[C@H]5C[C@]43O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Longaniaceae | Strychnos atlantica | Ref. |
| Plantae | Longaniaceae | Strychnos lucida R.Br. | Ref. |
| Plantae | Longaniaceae | Strychnos nux-vomica  | Ref. |
| Plantae | Longaniaceae | Strychnos spinosa  | Ref. |
| Plantae | Longaniaceae | Strychnos wallichiana | Ref. |
|
|
zoom in
| Organism | Strychnos nux-vomica | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|