| Name |
Integriamide |
| Formula |
C20H15NO6 |
| Mw |
365.08993722 |
| CAS RN |
72459-16-6 |
| C_ID |
C00024650
, 
|
| InChIKey |
TVGSPKUWBOWRHI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H15NO6/c1-21(8-22)20-12(14-6-18-19(7-15(14)23)27-10-26-18)3-2-11-4-16-17(5-13(11)20)25-9-24-16/h2-8,23H,9-10H2,1H3 |
| SMILES |
CN(C=O)c1c(-c2cc3c(cc2O)OCO3)ccc2cc3c(cc12)OCO3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Toddalia asiatica  | Ref. |
| Plantae | Rutaceae | Zanthoxylum integrifoliolum (Merr.) | Ref. |
| Plantae | Rutaceae | Zanthoxylum nitidum | Ref. |
|
|
zoom in
| Organism | Zanthoxylum nitidum |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
