| Name |
Lambertianic acid |
| Formula |
C20H28O3 |
| Mw |
316.20384476 |
| CAS RN |
4966-13-6 |
| C_ID |
C00022321
, 
|
| InChIKey |
ZQHJXKYYELWEOK-FTLAVVRGNA-N |
| InChICode |
InChI=1S/C20H28O3/c1-14-5-8-17-19(2,10-4-11-20(17,3)18(21)22)16(14)7-6-15-9-12-23-13-15/h9,12-13,16-17H,1,4-8,10-11H2,2-3H3,(H,21,22)/t16-,17+,19-,20-/m0/s1 |
| SMILES |
C=C1CC[C@@H]2[C@](C)(CCC[C@]2(C)C(=O)O)[C@H]1CCc1ccoc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cupressaceae | Biota orientalis (L.) ENDL. | Ref. |
| Plantae | Cupressaceae | Platycladus orientalis  | Ref. |
| Plantae | Cupressaceae | Thuja orientalis  | Ref. |
| Plantae | Pinaceae | Pinus koraiensis  | Ref. |
| Plantae | Pinaceae | Pinus lambertiana  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
|
|
zoom in
| Organism | Thuja orientalis | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Asili, et al., Journal of Natural Products, 67, (2004), 631 |
|---|
|