| Name |
(-)-Sativene Sativene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
6813-05-4 |
| C_ID |
C00021860
, 
|
| InChIKey |
VOBBUADSYROGAT-XOTHCGNINA-N |
| InChICode |
InChI=1S/C15H24/c1-9(2)11-7-8-15(4)10(3)12-5-6-13(15)14(11)12/h9,11-14H,3,5-8H2,1-2,4H3/t11-,12+,13+,14-,15+/m1/s1 |
| SMILES |
C=C1C2CCC3C2[C@@H](C(C)C)CC[C@@]13C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Pleosporaceae | Helminthosporium sativum | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
|
|
zoom in
| Organism | Turnera diffusa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|