| Name |
Velleral |
| Formula |
C15H20O2 |
| Mw |
232.14632988 |
| CAS RN |
50656-61-6 |
| C_ID |
C00021555
, 
|
| InChIKey |
GUAUUIHVMRMGCT-IGSXMHTDNA-N |
| InChICode |
InChI=1S/C15H20O2/c1-10-4-12(8-16)13(9-17)5-11-6-15(2,3)7-14(10)11/h4-5,8-11,14H,6-7H2,1-3H3/t10-,11+,14-/m1/s1 |
| SMILES |
C[C@H]1C=C(C=O)C(C=O)=C[C@@H]2CC(C)(C)C[C@@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Russulaceae | Lactarius pergamenus | Ref. |
| Fungi | Russulaceae | Lactarius pergameus | Ref. |
| Fungi | Russulaceae | Lactarius piperatus  | Ref. |
| Fungi | Russulaceae | Lactarius vellereus  | Ref. |
| Plantae | Zingiberaceae | Curcuma kwangsiensis  | Ref. |
|
|
zoom in
| Organism | Lactarius piperatus | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|