| Name |
Zedoarondiol |
| Formula |
C15H24O3 |
| Mw |
252.17254463 |
| CAS RN |
98644-24-7 |
| C_ID |
C00020357
, 
|
| InChIKey |
TXIKNNOOLCGADE-VMCIVVSMNA-N |
| InChICode |
InChI=1S/C15H24O3/c1-9(2)10-7-12-11(5-6-14(12,3)17)15(4,18)8-13(10)16/h11-12,17-18H,5-8H2,1-4H3/t11-,12+,14-,15+/m1/s1 |
| SMILES |
CC(C)=C1C[C@H]2[C@@H](CC[C@@]2(C)O)[C@@](C)(O)CC1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Zingiberaceae | Curcuma aeruginosa  | Ref. |
| Plantae | Zingiberaceae | Curcuma aromatica  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Curcuma zedoaria  | Ref. |
|
|
zoom in
| Organism | Curcuma longa | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
MATSUDA, et al., Chem Pharm Bull, 49, (2001), 1558 |
|---|
|