| Name |
Lacinilene A |
| Formula |
C14H16O |
| Mw |
200.12011513 |
| CAS RN |
40525-06-2 |
| C_ID |
C00020170
, 
|
| InChIKey |
IUYVYWGWLYHKNT-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C14H16O/c1-9(2)12-6-4-10(3)14-8-11(15)5-7-13(12)14/h4-9,15H,1-3H3 |
| SMILES |
Cc1ccc(C(C)C)c2ccc(O)cc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Malvaceae | Gossypium hirsutum  | Ref. |
| Plantae | Ulmaceae | Ulmus laciniata | Ref. |
| Plantae | Ulmaceae | Ulmus parvifolia | Ref. |
|
|
zoom in
| Organism | Ulmus parvifolia | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|