| Name |
Glyasperin C (3R)-7,2',4'-Trihydroxy-5-methoxy-6-prenylisoflavan |
| Formula |
C21H24O5 |
| Mw |
356.16237388 |
| CAS RN |
142474-53-1 |
| C_ID |
C00019753
, 
|
| InChIKey |
RCZMWVKBVFOCEE-UGPWUYPHNA-N |
| InChICode |
InChI=1S/C21H24O5/c1-12(2)4-6-16-19(24)10-20-17(21(16)25-3)8-13(11-26-20)15-7-5-14(22)9-18(15)23/h4-5,7,9-10,13,22-24H,6,8,11H2,1-3H3/t13-/m0/s1 |
| SMILES |
COc1c(CC=C(C)C)c(O)cc2c1C[C@H](c1ccc(O)cc1O)CO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycyrrhiza aspera | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
|
|
zoom in
| Organism | Glycyrrhiza inflata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|