| Name |
Isomaltose 6-O-alpha-D-Glucopyranosyl-D-glucose D-Isomaltose |
| Formula |
C12H22O11 |
| Mw |
342.11621155 |
| CAS RN |
499-40-1 |
| C_ID |
C00018660
, 
|
| InChIKey |
AYRXSINWFIIFAE-CRRTWRNQNA-N |
| InChICode |
InChI=1S/C12H22O11/c13-1-4(15)7(17)8(18)5(16)3-22-12-11(21)10(20)9(19)6(2-14)23-12/h1,4-12,14-21H,2-3H2/t4-,5+,6+,7+,8+,9+,10-,11-,12-/m0/s1 |
| SMILES |
O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO[C@H]1OC(CO)[C@@H](O)[C@H](O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Streptomycetaceae | Streptomyces No. 2265 | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Eucommiaceae | Eucommia ulmoides  | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Eucommia ulmoides | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|