| Name |
Endocrocin |
| Formula |
C16H10O7 |
| Mw |
314.04265268 |
| CAS RN |
481-70-9 |
| C_ID |
C00018257
, 
|
| InChIKey |
UZOHDKGTYVTYDZ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H10O7/c1-5-2-7-12(14(20)10(5)16(22)23)15(21)11-8(13(7)19)3-6(17)4-9(11)18/h2-4,17-18,20H,1H3,(H,22,23) |
| SMILES |
Cc1cc2c(c(O)c1C(=O)O)C(=O)c1c(O)cc(O)cc1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Incertae sedis | Pyrenochaeta terrestris | Ref. |
| Fungi | Trichocomaceae | Aspergillus fumigatus | Ref. |
| Plantae | Polygonaceae | Rumex dentatus  | Ref. |
| Plantae | Polygonaceae | Rumex vesicarius  | Ref. |
|
|
zoom in
| Organism | Rumex dentatus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|