| Name |
Ligularone |
| Formula |
C15H22O2 |
| Mw |
234.16197995 |
| CAS RN |
900789-90-4 |
| C_ID |
C00017372
, 
|
| InChIKey |
ANKFPIBCTISOBX-FYZIHCENNA-N |
| InChICode |
InChI=1S/C15H22O2/c1-9-8-17-12-7-11-6-4-5-10(2)15(11,3)14(16)13(9)12/h8,10-11,14,16H,4-7H2,1-3H3/t10-,11+,14+,15+/m0/s1 |
| SMILES |
Cc1coc2c1C(O)[C@@]1(C)[C@H](CCC[C@@H]1C)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ligularia fischeri | Ref. |
| Plantae | Asteraceae | Ligularia sibirica | Ref. |
| Plantae | Asteraceae | Petasites japonicus  | Ref. |
|
|
zoom in
| Organism | Petasites japonicus | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|