| Name |
Marchantin H |
| Formula |
C28H24O5 |
| Mw |
440.16237388 |
| CAS RN |
99481-36-4 |
| C_ID |
C00015815
, 
|
| InChIKey |
BVVNNKLMNVFVGS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C28H24O5/c29-24-14-9-20-5-4-19-2-1-3-23(16-19)33-28-21(11-15-25(30)27(28)31)10-6-18-7-12-22(13-8-18)32-26(24)17-20/h1-3,7-9,11-17,29-31H,4-6,10H2 |
| SMILES |
Oc1ccc2cc1Oc1ccc(cc1)CCc1ccc(O)c(O)c1Oc1cccc(c1)CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aytoniaceae | Asterella angusta | Ref. |
| Plantae | Aytoniaceae | Plagiochasma intermedium | Ref. |
| Plantae | Marchantiaceae | Marchantia diptera | Ref. |
| Plantae | Marchantiaceae | Marchantia polymorpha | Ref. |
| Plantae | Plagiochilaceae | Plagiochila sciophila | Ref. |
|
|
zoom in
| Organism | Marchantia diptera | | Reference | Wu,Some new findings on the chemistry of Taiwanese Liverworts, in Bryophytes, Their Chemistry and Chemical Taxonomy,Oxford University Press,(1990),71 |
|---|
|