| Name |
Licoagrochalcone A
3-Prenyl-4,2',4'-trihydroxychalcone |
| Formula |
C20H20O4 |
| Mw |
324.13615913 |
| CAS RN |
202815-28-9 |
| C_ID |
C00014456
, 
|
| InChIKey |
TVUGLERLRIQATC-BJMVGYQFSA-N |
| InChICode |
InChI=1S/C20H20O4/c1-13(2)3-6-15-11-14(4-9-18(15)22)5-10-19(23)17-8-7-16(21)12-20(17)24/h3-5,7-12,21-22,24H,6H2,1-2H3/b10-5+ |
| SMILES |
CC(C)=CCc1cc(/C=C/C(=O)c2ccc(O)cc2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Erythrina abussinica | Ref. |
| Plantae | Fabaceae | Erythrina abyssinica  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata | Ref. |
| Plantae | Fabaceae | Lespedeza cyrtobotrya | Ref. |
|
|
zoom in
| Organism | Glycyrrhiza glabra |
|---|
| Reference | Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Xing, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 28, (2003), 593.
Yenesew, et al., Phytochemistry, 65, (2004), 3029.
Yenesew, et al., Planta Med, 69, (2003), 658
Asada,Phytochem.,47,(1998),389 |
|---|
|
