| Name |
Acacetin 7-(2G-rhamnosyl)-rutinoside Apigenin 4'-methyl ether 7-(2G-rhamnosyl)-rutinoside Neobudofficide 7-[(O-6-deoxy-alpha-L-mannopyranosyl-(1->2)-O-[6-deoxy-alpha-L-mannopyranosyl-(1->6)]-beta-D-glucopyranosyl]oxy)-5-hydroxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C34H42O18 |
| Mw |
738.23711454 |
| CAS RN |
194602-91-0 |
| C_ID |
C00013627
, 
|
| InChIKey |
XQQFUXJSLVWQSS-VKMLBANYNA-N |
| InChICode |
InChI=1S/C34H42O18/c1-12-23(37)26(40)29(43)32(47-12)46-11-21-25(39)28(42)31(52-33-30(44)27(41)24(38)13(2)48-33)34(51-21)49-16-8-17(35)22-18(36)10-19(50-20(22)9-16)14-4-6-15(45-3)7-5-14/h4-10,12-13,21,23-35,37-44H,11H2,1-3H3/t12-,13-,21+,23-,24-,25+,26+,27+,28-,29-,30-,31-,32+,33-,34+/m0/s1 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)cc(O[C@@H]4OC(CO[C@@H]5OC(C)[C@H](O)C(O)[C@@H]5O)[C@@H](O)[C@H](O)C4O[C@@H]4OC(C)[C@H](O)C(O)[C@@H]4O)cc3o2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Buddlejaceae | Buddleia officinalis | Ref. |
| Plantae | Buddlejaceae | Buddleja officinalis  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana hardwickii  | Ref. |
|
|
zoom in
| Organism | Valeriana hardwickii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|