| Name |
Tricin 5,7,4'-Trihydroxy-3',5'-dimethoxyflavone 5,7-Dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
520-32-1 |
| C_ID |
C00013329
, 
|
| InChIKey |
HRGUSFBJBOKSML-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-22-14-3-8(4-15(23-2)17(14)21)12-7-11(20)16-10(19)5-9(18)6-13(16)24-12/h3-7,18-19,21H,1-2H3 |
| SMILES |
COc1cc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Asteraceae | Artemisia minor | Ref. |
| Plantae | Berberidaceae | Epimedium acuminatum | Ref. |
| Plantae | Berberidaceae | Epimedium brevicornum  | Ref. |
| Plantae | Berberidaceae | Epimedium koreanum  | Ref. |
| Plantae | Bromeliaceae | Aechmea glomerata | Ref. |
| Plantae | Connaraceae | Agelaea pentagyna  | Ref. |
| Plantae | Crassulaceae | Rhodiola sachalinensis  | Ref. |
| Plantae | Cucurbitaceae | Trichosanthes rosthornii  | Ref. |
| Plantae | Ephedraceae | Ephedra sinica  | Ref. |
| Plantae | Fabaceae | Hymenaea palustris Ducke | Ref. |
| Plantae | Fabaceae | Lespedeza virgata | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Trigonella foenum-graecum  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Iridaceae | Crocus aureus | Ref. |
| Plantae | Iridaceae | Crocus heuffelianus | Ref. |
| Plantae | Iridaceae | Crocus laevigatus | Ref. |
| Plantae | Labiatae | Leucas cephalotes SPRENG.  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Myoporaceae | Myoporum bontioides | Ref. |
| Plantae | Orobanchaceae | Castilleja fissifolia | Ref. |
| Plantae | Orobanchaceae | Pedicularis longiflora var. tubiformis | Ref. |
| Plantae | Palmae | Phoenix canariensis  | Ref. |
| Plantae | Poaceae | Gynerium sagittatum  | Ref. |
| Plantae | Poaceae | Miscanthus sinensis | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Phragmites communis  | Ref. |
| Plantae | Poaceae | Spartina cynosuroides | Ref. |
| Plantae | Ranunculaceae | Ranunculus japonicus | Ref. |
| Plantae | Smilacaceae | Smilax bracteata | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Thymelaeaceae | Wikstroemia indica  | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana laxiflora | Ref. |
| Plantae | Velloziaceae | Xerophyta retinervis  | Ref. |
|
|
zoom in
| Organism | Epimedium acuminatum | | Reference | Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Li, et al., ZYZ, 30, (1995), 455.
Liang, et al., CCMM, 18, (1993), 677.
Shang, et al., CCMM, 23, (1998), 614.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Gu, et al., Planta Med, 70, (2004), 509 |
|---|
|