| Name |
Corymbolone [4S-(4alpha,4abeta,6alpha,8aalpha)]-Octahydro-4a-hydroxy-4,8a-dimethyl-6-(1-methylethenyl)-1(2H)-naphthalenone |
| Formula |
C15H24O2 |
| Mw |
236.17763001 |
| CAS RN |
97094-19-4 |
| C_ID |
C00012791
, 
|
| InChIKey |
BMGSSZITOGSORO-VMCIVVSMNA-N |
| InChICode |
InChI=1S/C15H24O2/c1-10(2)12-7-8-14(4)13(16)6-5-11(3)15(14,17)9-12/h11-12,17H,1,5-9H2,2-4H3/t11-,12+,14-,15+/m0/s1 |
| SMILES |
C=C(C)[C@@H]1CC[C@@]2(C)C(=O)CC[C@H](C)[C@]2(O)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
| Plantae | Cyperaceae | Cyperus corymbosus | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
|
|
zoom in
| Organism | Curcuma longa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|