| Name |
alpha-Bisabolol oxide B (-)-alpha-Bisabolol oxide B (-)-Bisabolol oxide B Bisabolol oxide II |
| Formula |
C15H26O2 |
| Mw |
238.19328007 |
| CAS RN |
26184-88-3 |
| C_ID |
C00011652
, 
|
| InChIKey |
RKBAYVATPNYHLW-BCGKOALKNA-N |
| InChICode |
InChI=1S/C15H26O2/c1-11-5-7-12(8-6-11)15(4)10-9-13(17-15)14(2,3)16/h5,12-13,16H,6-10H2,1-4H3/t12-,13+,15+/m1/s1 |
| SMILES |
CC1=CC[C@@H]([C@]2(C)CC[C@@H](C(C)(C)O)O2)CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Caryophyllaceae | Stellaria pallida | Ref. |
| Plantae | Myrtaceae | Melaleuca leucadendra L.  | Ref. |
| - | - | Chamaemalum nobile | Ref. |
|
|
zoom in
| Organism | Stellaria pallida | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|