| Name |
(-)-Curcuphenol (R)-(-)-Curcuphenol (R)-Curcuphenol Curcuphenol |
| Formula |
C15H22O |
| Mw |
218.16706532 |
| CAS RN |
69301-27-5 |
| C_ID |
C00011620
, 
|
| InChIKey |
BTXSROVNGICYFE-UGPWUYPHNA-N |
| InChICode |
InChI=1S/C15H22O/c1-11(2)6-5-7-13(4)14-9-8-12(3)10-15(14)16/h6,8-10,13,16H,5,7H2,1-4H3/t13-/m1/s1 |
| SMILES |
CC(C)=CCC[C@@H](C)c1ccc(C)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Lasianthaea podocephala | Ref. |
| Plantae | Zingiberaceae | Curcuma amada  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| - | - | Pseudopterogorgia rigida | Ref. |
|
|
zoom in
| Organism | Curcuma longa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|