| Name |
Bisabolangelone Angelikoreanol Ligustilone |
| Formula |
C15H20O3 |
| Mw |
248.1412445 |
| CAS RN |
30557-81-4 |
| C_ID |
C00011610
, 
|
| InChIKey |
GNWNPLBSEQDDQV-CKQGBPMSNA-N |
| InChICode |
InChI=1S/C15H20O3/c1-9(2)5-6-13-15(4,17)14-11(16)7-10(3)8-12(14)18-13/h5-7,12,14,17H,8H2,1-4H3/b13-6-/t12-,14+,15-/m1/s1 |
| SMILES |
CC(C)=C/C=C1O[C@@H]2CC(C)=CC(=O)[C@@H]2[C@]1(C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Angelica pubescens f.biserrta  | Ref. |
| Plantae | Apiaceae | Angelica silvestris  | Ref. |
| Plantae | Oleaceae | Ligustrum sinense | Ref. |
|
|
zoom in
| Organism | Ligustrum sinense | | Reference | Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|