| Name |
Cytochalasin B Phomin |
| Formula |
C29H37NO5 |
| Mw |
479.2671733 |
| CAS RN |
14930-96-2 |
| C_ID |
C00011322
, 
|
| InChIKey |
GBOGMAARMMDZGR-YKKWCZCSNA-N |
| InChICode |
InChI=1S/C29H37NO5/c1-18-9-7-13-22(31)15-16-25(32)35-29-23(14-8-10-18)27(33)20(3)19(2)26(29)24(30-28(29)34)17-21-11-5-4-6-12-21/h4-6,8,11-12,14-16,18-19,22-24,26-27,31,33H,3,7,9-10,13,17H2,1-2H3,(H,30,34)/b14-8+,16-15+/t18-,19-,22-,23+,24+,26+,27-,29-/m1/s1 |
| SMILES |
C=C1[C@@H](C)C2C(Cc3ccccc3)NC(=O)[C@]23OC(=O)/C=C/[C@H](O)CCC[C@@H](C)C/C=C/[C@H]3[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Gnomoniaceae | Gnomonia erythrostoma | Ref. |
| Fungi | Hypocreaceae | Hypomyces odoratus | Ref. |
| Fungi | Incertae sedis | Ascochyta heteromorpha | Ref. |
| Fungi | Incertae sedis | Phoma exigua var. exigua | Ref. |
| Fungi | Pleosporaceae | Cochliobolus lunatus | Ref. |
| Fungi | Pleosporaceae | Drechslera biseptata | Ref. |
| Fungi | Pleosporaceae | Helminthosporium dematioideum | Ref. |
| Fungi | Pleosporaceae | Pyrenophora semeniperda | Ref. |
| - | - | Hormiscium spp. | Ref. |
|
|
zoom in
| Organism | Ascochyta heteromorpha | | Reference | Cole,Handbook of Secondary Fungal Metabolites,Volume I,(2003)
Cole,Handbook of Toxic Fungal Metabolites,(1981),281
Nator,Mycotoxins and Phytoalexins,(1991),291 |
|---|
|