| Name |
Preechinulin |
| Formula |
C19H23N3O2 |
| Mw |
325.179027 |
| CAS RN |
21008-43-5 |
| C_ID |
C00011282
, 
|
| InChIKey |
LVPZJIGICMPWFH-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C19H23N3O2/c1-5-19(3,4)16-13(12-8-6-7-9-14(12)21-16)10-15-18(24)20-11(2)17(23)22-15/h5-9,11,15,21H,1,10H2,2-4H3,(H,20,24)(H,22,23)/t11-,15+/m0/s1 |
| SMILES |
C=CC(C)(C)c1[nH]c2ccccc2c1CC1NC(=O)C(C)NC1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Trichocomaceae | Aspergillus variecolor | Ref. |
| Fungi | Trichocomaceae | Eurotium amstelodami | Ref. |
| Fungi | Trichocomaceae | Eurotium chevalieri | Ref. |
| Fungi | Trichocomaceae | Eurotium echinulatum | Ref. |
|
|
zoom in
| Organism | Eurotium chevalieri | | Reference | Cole,Handbook of Secondary Fungal Metabolites,Volume I,(2003)
Cole,Handbook of Toxic Fungal Metabolites,(1981),459
Turner,Fungal Metabolites II,(1983),631 |
|---|
|