| Name |
Pongamoside D |
| Formula |
C23H22O11 |
| Mw |
474.11621155 |
| CAS RN |
713524-66-4 |
| C_ID |
C00011170
, 
|
| InChIKey |
RQSSRCUNGIYPIQ-KULBGAJJNA-N |
| InChICode |
InChI=1S/C23H22O11/c1-29-22-17(25)12-4-3-11(32-23-20(28)19(27)18(26)16(8-24)34-23)7-14(12)33-21(22)10-2-5-13-15(6-10)31-9-30-13/h2-7,16,18-20,23-24,26-28H,8-9H2,1H3/t16-,18-,19+,20-,23-/m1/s1 |
| SMILES |
COc1c(-c2ccc3c(c2)OCO3)oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)ccc2c1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Millettia pinnata | Ref. |
| Plantae | Fabaceae | Pongamia pinnata  | Ref. |
| Plantae | Solanaceae | Hyoscyamus niger  | Ref. |
|
|
zoom in
| Organism | Hyoscyamus niger | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|