| Name |
Pongamoside C |
| Formula |
C24H22O10 |
| Mw |
470.12129692 |
| CAS RN |
713524-65-3 |
| C_ID |
C00011169
, 
|
| InChIKey |
ADILGNQVWRXLRO-QDAYXBOJNA-N |
| InChICode |
InChI=1S/C24H22O10/c1-30-23-16(26)13-9-14(32-24-19(29)18(28)17(27)15(10-25)33-24)22-12(7-8-31-22)21(13)34-20(23)11-5-3-2-4-6-11/h2-9,15,17-19,24-25,27-29H,10H2,1H3/t15-,17+,18+,19-,24-/m1/s1 |
| SMILES |
COc1c(-c2ccccc2)oc2c(cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c3occc32)c1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Millettia pinnata | Ref. |
| Plantae | Fabaceae | Pongamia pinnata  | Ref. |
| Plantae | Solanaceae | Hyoscyamus niger | Ref. |
|
|
zoom in
| Organism | Hyoscyamus niger |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
