| Name |
(+)-Paeoniflorigenone Paeoniflorigenone |
| Formula |
C17H18O6 |
| Mw |
318.11033831 |
| CAS RN |
80454-42-8 |
| C_ID |
C00010954
, 
|
| InChIKey |
BANPEMKDTXIFRE-SOHHNPLFNA-N |
| InChICode |
InChI=1S/C17H18O6/c1-16-8-13(18)11-7-17(16,20)23-15(22-16)12(11)9-21-14(19)10-5-3-2-4-6-10/h2-6,11-12,15,20H,7-9H2,1H3/t11-,12+,15+,16+,17+/m1/s1 |
| SMILES |
C[C@]12CC(=O)[C@@H]3C[C@@]1(O)OC(O2)C3COC(=O)c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Paeoniaceae | Paeonia albiflora  | Ref. |
| Plantae | Paeoniaceae | Paeonia hybrida | Ref. |
| Plantae | Paeoniaceae | Paeonia lactiflora wild  | Ref. |
| Plantae | Paeoniaceae | Paeonia peregrina | Ref. |
| Plantae | Paeoniaceae | Paeonia suffruticosa ANDREWS  | Ref. |
|
|
zoom in
| Organism | Paeonia lactiflora wild | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Shimizu, et al., Chem Pharm Bull, 31, (1983), 577 |
|---|
|