| Name |
7-Ketologanin Dehydrologanin Ketologanin |
| Formula |
C17H24O10 |
| Mw |
388.13694699 |
| CAS RN |
152-91-0 |
| C_ID |
C00010605
, 
|
| InChIKey |
LPOVXLVQNSEZGE-ZAEQJUMHNA-N |
| InChICode |
InChI=1S/C17H24O10/c1-6-9(19)3-7-8(15(23)24-2)5-25-16(11(6)7)27-17-14(22)13(21)12(20)10(4-18)26-17/h5-7,10-14,16-18,20-22H,3-4H2,1-2H3/t6-,7+,10-,11-,12+,13+,14-,16-,17-/m0/s1 |
| SMILES |
COC(=O)C1=CO[C@@H](OC2OC(CO)[C@@H](O)C(O)[C@@H]2O)[C@H]2[C@@H]1CC(=O)[C@@H]2C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Vinca rosea  | Ref. |
| Plantae | Longaniaceae | Strychnos nux-vomica  | Ref. |
| Plantae | Oleaceae | Jasminum grandiflorum  | Ref. |
| Plantae | Oleaceae | Jasminum hemsleyi Yamamoto | Ref. |
| Plantae | Oleaceae | Jasminum odoratissinum L. | Ref. |
| Plantae | Oleaceae | Jasminum officinale  | Ref. |
| Plantae | Oleaceae | Ligustrum lucidum Ait.  | Ref. |
| Plantae | Oleaceae | Osmanthus austrocaledonicus (Vieill.) Knobl. | Ref. |
| Plantae | Oleaceae | Picconia excelsa (Aiton) DC. | Ref. |
|
|
zoom in
| Organism | Jasminum grandiflorum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|