| Name |
Brasoside |
| Formula |
C16H22O9 |
| Mw |
358.1263823 |
| CAS RN |
70980-41-5 |
| C_ID |
C00010500
, 
|
| InChIKey |
QFPBGXPLBMXTBI-OHZXMWNWNA-N |
| InChICode |
InChI=1S/C16H22O9/c1-5-2-7-10-6(14(21)23-7)4-22-15(9(5)10)25-16-13(20)12(19)11(18)8(3-17)24-16/h4-5,7-13,15-20H,2-3H2,1H3/t5-,7-,8+,9+,10-,11+,12-,13-,15-,16-/m0/s1 |
| SMILES |
C[C@H]1C[C@@H]2OC(=O)C3=CO[C@@H](O[C@@H]4OC(CO)[C@@H](O)C(O)[C@@H]4O)[C@H]1[C@@H]32 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Verbenaceae | Verbena brasiliensis | Ref. |
| Plantae | Verbenaceae | Verbena hastata | Ref. |
| Plantae | Verbenaceae | Verbena officinalis  | Ref. |
| Plantae | Verbenaceae | Verbena spp. | Ref. |
|
|
zoom in
| Organism | Verbena officinalis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|