| Name |
Genistein 7,4'-O-diglucoside Genistein 7,4'-di-O-glucoside Genistein-7,4'-di-O-beta-glucopyranoside |
| Formula |
C27H30O15 |
| Mw |
594.15847029 |
| CAS RN |
36190-98-4 |
| C_ID |
C00010106
, 
|
| InChIKey |
OUJDQONJYHNTDX-MHCRMHAINA-N |
| InChICode |
InChI=1S/C27H30O15/c28-7-16-20(32)22(34)24(36)26(41-16)39-11-3-1-10(2-4-11)13-9-38-15-6-12(5-14(30)18(15)19(13)31)40-27-25(37)23(35)21(33)17(8-29)42-27/h1-6,9,16-17,20-30,32-37H,7-8H2/t16-,17+,20-,21-,22+,23+,24-,25-,26-,27-/m1/s1 |
| SMILES |
O=c1c(-c2ccc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)cc2)coc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Lupinus albus L.  | Ref. |
| Plantae | Fabaceae | Lupinus hartwegii | Ref. |
| Plantae | Fabaceae | Lupinus perennis  | Ref. |
| Plantae | Fabaceae | Piptanthus nepalensis | Ref. |
| Plantae | Fabaceae | Psoralea effusa | Ref. |
| Plantae | Fabaceae | Psoralea fascicularis | Ref. |
| Plantae | Fabaceae | Psoralea laxa | Ref. |
| Plantae | Fabaceae | Psoralea oligophylla | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Thermopsis mollis | Ref. |
| Plantae | Fabaceae | Thermopsis rhombifolia | Ref. |
| Plantae | Fabaceae | Thermopsis villosa | Ref. |
|
|
zoom in
| Organism | Lupinus perennis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Dement,Phytochem.,11,(1972),1089 |
|---|
|