| Name |
Mirificoumestan hydrate 3,9-Dihydroxy-8-methoxy-7-(3-hydroxy-3-methylbutyl)coumestan |
| Formula |
C21H20O7 |
| Mw |
384.12090299 |
| CAS RN |
114865-44-0 |
| C_ID |
C00010056
, 
|
| InChIKey |
TUTUMQZQMWKQLL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C21H20O7/c1-21(2,25)7-6-12-16-15(9-13(23)18(12)26-3)27-19-11-5-4-10(22)8-14(11)28-20(24)17(16)19/h4-5,8-9,22-23,25H,6-7H2,1-3H3 |
| SMILES |
COc1c(O)cc2oc3c4ccc(O)cc4oc(=O)c3c2c1CCC(C)(C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Acacia pendula | Ref. |
| Plantae | Fabaceae | Acacia pycnantha | Ref. |
| Plantae | Fabaceae | Pueraria mirifica  | Ref. |
|
|
zoom in
| Organism | Pueraria mirifica | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Ingham,Z.Naturforsch.C,43,(1988),5 |
|---|
|