| Name |
Phaseol 3,9-Dihydroxy-4-prenylcoumestan |
| Formula |
C20H16O5 |
| Mw |
336.09977362 |
| CAS RN |
88478-02-8 |
| C_ID |
C00010051
, 
|
| InChIKey |
FRXPSBUCIWPZMH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H16O5/c1-10(2)3-5-12-15(22)8-7-14-18(12)25-20(23)17-13-6-4-11(21)9-16(13)24-19(14)17/h3-4,6-9,21-22H,5H2,1-2H3 |
| SMILES |
CC(C)=CCc1c(O)ccc2c1oc(=O)c1c3ccc(O)cc3oc21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza sp. | Ref. |
| Plantae | Fabaceae | Phaseolus aureus  | Ref. |
|
|
zoom in
| Organism | Phaseolus aureus | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
O'Neil,Z.Naturforsch.C,38,(1983),698 |
|---|
|