| Name |
1-Methoxyficifolinol 3,9-Dihydroxy-1-methoxy-2,8-diprenylpterocarpan |
| Formula |
C26H30O5 |
| Mw |
422.20932407 |
| CAS RN |
129280-35-9 |
| C_ID |
C00010018
, 
|
| InChIKey |
WIEKYGJSRGBBTQ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C26H30O5/c1-14(2)6-8-16-10-18-19-13-30-23-12-21(28)17(9-7-15(3)4)25(29-5)24(23)26(19)31-22(18)11-20(16)27/h6-7,10-12,19,26-28H,8-9,13H2,1-5H3/t19-,26+/m1/s1 |
| SMILES |
COc1c(CC=C(C)C)c(O)cc2c1C1Oc3cc(O)c(CC=C(C)C)cc3C1CO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycyrrhiza aspera | Ref. |
| Plantae | Fabaceae | Glycyrrhiza sp. | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
|
|
zoom in
| Organism | Glycyrrhiza uralensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Kiuchi,Heterocycles,31,(1990),629 |
|---|
|